C36H68N2O4 — CID 22323173
bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) decanedioate (PubChem CID 22323173) has the molecular formula C36H68N2O4 and a molecular weight of 592.95 g/mol. Its IUPAC name is bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) decanedioate.
| Compound Name | bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 22323173 |
| Molecular Formula | C36H68N2O4 |
| Molecular Weight | 592.95 g/mol |
| Exact Mass | 592.52 |
| IUPAC Name | bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) decanedioate |
| SMILES | CCC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(CC)N(C)C(C)(CC)C2C)C(C)C(C)(CC)N1C |
| InChI | InChI=1S/C36H68N2O4/c1-13-33(7)25-29(27(5)35(9,15-3)37(33)11)41-31(39)23-21-19-17-18-20-22-24-32(40)42-30-26-34(8,14-2)38(12)36(10,16-4)28(30)6/h27-30H,13-26H2,1-12H3 |
| InChIKey | WRMAIUJBSHAUIB-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.95 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|