C14H26NO3- — CID 142844351
(2,6-diethyl-2,3,6-trimethyl-1-oxidopiperidin-4-yl) acetate (PubChem CID 142844351) has the molecular formula C14H26NO3- and a molecular weight of 256.37 g/mol. Its IUPAC name is (2,6-diethyl-2,3,6-trimethyl-1-oxidopiperidin-4-yl) acetate.
| Compound Name | (2,6-diethyl-2,3,6-trimethyl-1-oxidopiperidin-4-yl) acetate |
|---|---|
| PubChem CID | 142844351 |
| Molecular Formula | C14H26NO3- |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (2,6-diethyl-2,3,6-trimethyl-1-oxidopiperidin-4-yl) acetate |
| SMILES | CCC1(C)CC(OC(C)=O)C(C)C(C)(CC)N1[O-] |
| InChI | InChI=1S/C14H26NO3/c1-7-13(5)9-12(18-11(4)16)10(3)14(6,8-2)15(13)17/h10,12H,7-9H2,1-6H3/q-1 |
| InChIKey | BBPJVWPJQLDJIJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |