C13H25NO3 — CID 91405439
(2,6-diethyl-1-hydroxy-2,3,6-trimethylpiperidin-4-yl) formate (PubChem CID 91405439) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (2,6-diethyl-1-hydroxy-2,3,6-trimethylpiperidin-4-yl) formate.
| Compound Name | (2,6-diethyl-1-hydroxy-2,3,6-trimethylpiperidin-4-yl) formate |
|---|---|
| PubChem CID | 91405439 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (2,6-diethyl-1-hydroxy-2,3,6-trimethylpiperidin-4-yl) formate |
| SMILES | CCC1(C)CC(OC=O)C(C)C(C)(CC)N1O |
| InChI | InChI=1S/C13H25NO3/c1-6-12(4)8-11(17-9-15)10(3)13(5,7-2)14(12)16/h9-11,16H,6-8H2,1-5H3 |
| InChIKey | JYNHZKDVOKFECS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|