C21H34N2O6 — CID 69292930
2-[2-(2,6-diethyl-2,3,6-trimethyl-4-prop-2-enoyloxypiperidin-1-yl)oxypropanoylamino]prop-2-enoic acid (PubChem CID 69292930) has the molecular formula C21H34N2O6 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[2-(2,6-diethyl-2,3,6-trimethyl-4-prop-2-enoyloxypiperidin-1-yl)oxypropanoylamino]prop-2-enoic acid.
| Compound Name | 2-[2-(2,6-diethyl-2,3,6-trimethyl-4-prop-2-enoyloxypiperidin-1-yl)oxypropanoylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 69292930 |
| Molecular Formula | C21H34N2O6 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-[2-(2,6-diethyl-2,3,6-trimethyl-4-prop-2-enoyloxypiperidin-1-yl)oxypropanoylamino]prop-2-enoic acid |
| SMILES | C=CC(=O)OC1CC(C)(CC)N(OC(C)C(=O)NC(=C)C(=O)O)C(C)(CC)C1C |
| InChI | InChI=1S/C21H34N2O6/c1-9-17(24)28-16-12-20(7,10-2)23(21(8,11-3)13(16)4)29-15(6)18(25)22-14(5)19(26)27/h9,13,15-16H,1,5,10-12H2,2-4,6-8H3,(H,22,25)(H,26,27) |
| InChIKey | YZRIJZIPRADFQH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|