C24H35NO5 — CID 91592608
4-[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 91592608) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | 4-[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 91592608 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 4-[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | CCC1(C)CC(OC(=O)C=CC(=O)O)C(C)C(C)(CC)N1OCCc1ccccc1 |
| InChI | InChI=1S/C24H35NO5/c1-6-23(4)17-20(30-22(28)14-13-21(26)27)18(3)24(5,7-2)25(23)29-16-15-19-11-9-8-10-12-19/h8-14,18,20H,6-7,15-17H2,1-5H3,(H,26,27) |
| InChIKey | KFAGVHIHCCLUMX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|