C28H36N2O3 — CID 91220938
2-[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl]isoindole-1,3-dione (PubChem CID 91220938) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91220938 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 2-[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl]isoindole-1,3-dione |
| SMILES | CCC1(C)CC(N2C(=O)c3ccccc3C2=O)C(C)C(C)(CC)N1OCCc1ccccc1 |
| InChI | InChI=1S/C28H36N2O3/c1-6-27(4)19-24(29-25(31)22-15-11-12-16-23(22)26(29)32)20(3)28(5,7-2)30(27)33-18-17-21-13-9-8-10-14-21/h8-16,20,24H,6-7,17-19H2,1-5H3 |
| InChIKey | XUMDRAJDXGOERB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|