C25H41NO3 — CID 91222787
8,10-diethyl-3,3,8,10,11-pentamethyl-9-(2-phenylethoxy)-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 91222787) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is 8,10-diethyl-3,3,8,10,11-pentamethyl-9-(2-phenylethoxy)-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 8,10-diethyl-3,3,8,10,11-pentamethyl-9-(2-phenylethoxy)-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 91222787 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 8,10-diethyl-3,3,8,10,11-pentamethyl-9-(2-phenylethoxy)-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CCC1(C)CC2(OCC(C)(C)CO2)C(C)C(C)(CC)N1OCCc1ccccc1 |
| InChI | InChI=1S/C25H41NO3/c1-8-23(6)17-25(27-18-22(4,5)19-28-25)20(3)24(7,9-2)26(23)29-16-15-21-13-11-10-12-14-21/h10-14,20H,8-9,15-19H2,1-7H3 |
| InChIKey | HECXAGFQDZRIBZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |