About (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane
(2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane (PubChem CID 101015711) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane.
Molecular Properties
| Compound Name | (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane |
| PubChem CID | 101015711 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane |
| SMILES | CC1(C)COC2(C[C@H]2CCc2ccccc2)OC1 |
| InChI | InChI=1S/C16H22O2/c1-15(2)11-17-16(18-12-15)10-14(16)9-8-13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | QHPABDASCLWNRB-CQSZACIVSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane?
The IUPAC name of (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane (CID 101015711) is (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane.
What is the SMILES notation for (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane?
The canonical SMILES for (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane is CC1(C)COC2(C[C@H]2CCc2ccccc2)OC1.
What is the InChIKey of (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane?
The InChIKey is QHPABDASCLWNRB-CQSZACIVSA-N. The full InChI is InChI=1S/C16H22O2/c1-15(2)11-17-16(18-12-15)10-14(16)9-8-13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3/t14-/m1/s1.
What are the key properties of (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane?
(2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane has a molecular weight of 246.35 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6,6-dimethyl-2-(2-phenylethyl)-4,8-dioxaspiro[2.5]octane is sourced from PubChem (CID 101015711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).