C18H26O3 — CID 118113177
9-benzyl-3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ol (PubChem CID 118113177) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 9-benzyl-3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ol.
| Compound Name | 9-benzyl-3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ol |
|---|---|
| PubChem CID | 118113177 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 9-benzyl-3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ol |
| SMILES | CC1(C)COC2(CCC(O)(Cc3ccccc3)CC2)OC1 |
| InChI | InChI=1S/C18H26O3/c1-16(2)13-20-18(21-14-16)10-8-17(19,9-11-18)12-15-6-4-3-5-7-15/h3-7,19H,8-14H2,1-2H3 |
| InChIKey | WCLIIAAACDXLER-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |