C17H22 — CID 102494127
(2R,3R)-8-methyl-2-(2-phenylethyl)spiro[2.5]oct-7-ene (PubChem CID 102494127) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is (2R,3R)-8-methyl-2-(2-phenylethyl)spiro[2.5]oct-7-ene.
| Compound Name | (2R,3R)-8-methyl-2-(2-phenylethyl)spiro[2.5]oct-7-ene |
|---|---|
| PubChem CID | 102494127 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (2R,3R)-8-methyl-2-(2-phenylethyl)spiro[2.5]oct-7-ene |
| SMILES | CC1=CCCC[C@]12C[C@H]2CCc1ccccc1 |
| InChI | InChI=1S/C17H22/c1-14-7-5-6-12-17(14)13-16(17)11-10-15-8-3-2-4-9-15/h2-4,7-9,16H,5-6,10-13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | DUMOLFSYOIIPFP-SJORKVTESA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|