C13H19N — CID 102513783
N,N-dimethyl-1-(2-phenylethyl)cyclopropan-1-amine (PubChem CID 102513783) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-phenylethyl)cyclopropan-1-amine.
| Compound Name | N,N-dimethyl-1-(2-phenylethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 102513783 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N,N-dimethyl-1-(2-phenylethyl)cyclopropan-1-amine |
| SMILES | CN(C)C1(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C13H19N/c1-14(2)13(10-11-13)9-8-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| InChIKey | FBAFDOSPJYLAFA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |