About (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate
(5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate (PubChem CID 91004116) has the molecular formula C28H34N2O3
and a molecular weight of 446.59 g/mol. Its IUPAC name is (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate.
Molecular Properties
| Compound Name | (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate |
| PubChem CID | 91004116 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate |
| SMILES | CN(C)C1(CCc2ccccc2)CCC(NC(=O)Oc2ccc(Cc3ccccc3)o2)CC1 |
| InChI | InChI=1S/C28H34N2O3/c1-30(2)28(18-15-22-9-5-3-6-10-22)19-16-24(17-20-28)29-27(31)33-26-14-13-25(32-26)21-23-11-7-4-8-12-23/h3-14,24H,15-21H2,1-2H3,(H,29,31) |
| InChIKey | YJQZYWNFSHCDQS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate?
The IUPAC name of (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate (CID 91004116) is (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate.
What is the SMILES notation for (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate?
The canonical SMILES for (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate is CN(C)C1(CCc2ccccc2)CCC(NC(=O)Oc2ccc(Cc3ccccc3)o2)CC1.
What is the InChIKey of (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate?
The InChIKey is YJQZYWNFSHCDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O3/c1-30(2)28(18-15-22-9-5-3-6-10-22)19-16-24(17-20-28)29-27(31)33-26-14-13-25(32-26)21-23-11-7-4-8-12-23/h3-14,24H,15-21H2,1-2H3,(H,29,31).
What are the key properties of (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate?
(5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate has a molecular weight of 446.59 g/mol, XLogP of 5.83, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzylfuran-2-yl) N-[4-(dimethylamino)-4-(2-phenylethyl)cyclohexyl]carbamate is sourced from PubChem (CID 91004116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).