About (5-benzylfuran-2-yl) 2-nitrosobutanoate
(5-benzylfuran-2-yl) 2-nitrosobutanoate (PubChem CID 54398216) has the molecular formula C15H15NO4
and a molecular weight of 273.29 g/mol. Its IUPAC name is (5-benzylfuran-2-yl) 2-nitrosobutanoate.
Molecular Properties
| Compound Name | (5-benzylfuran-2-yl) 2-nitrosobutanoate |
| PubChem CID | 54398216 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (5-benzylfuran-2-yl) 2-nitrosobutanoate |
| SMILES | CCC(N=O)C(=O)Oc1ccc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C15H15NO4/c1-2-13(16-18)15(17)20-14-9-8-12(19-14)10-11-6-4-3-5-7-11/h3-9,13H,2,10H2,1H3 |
| InChIKey | VLNKCPBCWHRKRB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-benzylfuran-2-yl) 2-nitrosobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzylfuran-2-yl) 2-nitrosobutanoate?
The IUPAC name of (5-benzylfuran-2-yl) 2-nitrosobutanoate (CID 54398216) is (5-benzylfuran-2-yl) 2-nitrosobutanoate.
What is the SMILES notation for (5-benzylfuran-2-yl) 2-nitrosobutanoate?
The canonical SMILES for (5-benzylfuran-2-yl) 2-nitrosobutanoate is CCC(N=O)C(=O)Oc1ccc(Cc2ccccc2)o1.
What is the InChIKey of (5-benzylfuran-2-yl) 2-nitrosobutanoate?
The InChIKey is VLNKCPBCWHRKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4/c1-2-13(16-18)15(17)20-14-9-8-12(19-14)10-11-6-4-3-5-7-11/h3-9,13H,2,10H2,1H3.
What are the key properties of (5-benzylfuran-2-yl) 2-nitrosobutanoate?
(5-benzylfuran-2-yl) 2-nitrosobutanoate has a molecular weight of 273.29 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzylfuran-2-yl) 2-nitrosobutanoate is sourced from PubChem (CID 54398216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).