C24H33NO — CID 10157071
4-(dimethylamino)-1,4-bis(2-phenylethyl)cyclohexan-1-ol (PubChem CID 10157071) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 4-(dimethylamino)-1,4-bis(2-phenylethyl)cyclohexan-1-ol.
| Compound Name | 4-(dimethylamino)-1,4-bis(2-phenylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10157071 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 4-(dimethylamino)-1,4-bis(2-phenylethyl)cyclohexan-1-ol |
| SMILES | CN(C)C1(CCc2ccccc2)CCC(O)(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H33NO/c1-25(2)23(15-13-21-9-5-3-6-10-21)17-19-24(26,20-18-23)16-14-22-11-7-4-8-12-22/h3-12,26H,13-20H2,1-2H3 |
| InChIKey | OMFAIKOPOYBZAE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |