C23H30ClNO — CID 12711957
4-(4-chlorophenyl)-4-(dimethylamino)-1-(3-phenylpropyl)cyclohexan-1-ol (PubChem CID 12711957) has the molecular formula C23H30ClNO and a molecular weight of 371.95 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-(dimethylamino)-1-(3-phenylpropyl)cyclohexan-1-ol.
| Compound Name | 4-(4-chlorophenyl)-4-(dimethylamino)-1-(3-phenylpropyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 12711957 |
| Molecular Formula | C23H30ClNO |
| Molecular Weight | 371.95 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 4-(4-chlorophenyl)-4-(dimethylamino)-1-(3-phenylpropyl)cyclohexan-1-ol |
| SMILES | CN(C)C1(c2ccc(Cl)cc2)CCC(O)(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30ClNO/c1-25(2)23(20-10-12-21(24)13-11-20)17-15-22(26,16-18-23)14-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-13,26H,6,9,14-18H2,1-2H3 |
| InChIKey | RMYJUOJHZLDDLW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |