About (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine
(3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine (PubChem CID 171771140) has the molecular formula C19H32N2
and a molecular weight of 288.48 g/mol. Its IUPAC name is (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine.
Molecular Properties
| Compound Name | (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine |
| PubChem CID | 171771140 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine |
| SMILES | CN(C)[C@@]1(CCc2ccccc2)CCCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C19H32N2/c1-18(2,3)21-15-9-13-19(16-21,20(4)5)14-12-17-10-7-6-8-11-17/h6-8,10-11H,9,12-16H2,1-5H3/t19-/m1/s1 |
| InChIKey | TYTRWEFKCWJKCC-LJQANCHMSA-N |
| XLogP | 3.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine?
The IUPAC name of (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine (CID 171771140) is (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine.
What is the SMILES notation for (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine?
The canonical SMILES for (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine is CN(C)[C@@]1(CCc2ccccc2)CCCN(C(C)(C)C)C1.
What is the InChIKey of (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine?
The InChIKey is TYTRWEFKCWJKCC-LJQANCHMSA-N. The full InChI is InChI=1S/C19H32N2/c1-18(2,3)21-15-9-13-19(16-21,20(4)5)14-12-17-10-7-6-8-11-17/h6-8,10-11H,9,12-16H2,1-5H3/t19-/m1/s1.
What are the key properties of (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine?
(3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine has a molecular weight of 288.48 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-tert-butyl-N,N-dimethyl-3-(2-phenylethyl)piperidin-3-amine is sourced from PubChem (CID 171771140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).