C15H21Br2N — CID 134925079
2-(bromomethyl)-4,4-dimethyl-1-(2-phenylethyl)-2,3-dihydropyrrol-1-ium bromide (PubChem CID 134925079) has the molecular formula C15H21Br2N and a molecular weight of 375.15 g/mol. Its IUPAC name is 2-(bromomethyl)-4,4-dimethyl-1-(2-phenylethyl)-2,3-dihydropyrrol-1-ium bromide.
| Compound Name | 2-(bromomethyl)-4,4-dimethyl-1-(2-phenylethyl)-2,3-dihydropyrrol-1-ium bromide |
|---|---|
| PubChem CID | 134925079 |
| Molecular Formula | C15H21Br2N |
| Molecular Weight | 375.15 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2-(bromomethyl)-4,4-dimethyl-1-(2-phenylethyl)-2,3-dihydropyrrol-1-ium bromide |
| SMILES | CC1(C)C=[N+](CCc2ccccc2)C(CBr)C1.[Br-] |
| InChI | InChI=1S/C15H21BrN.BrH/c1-15(2)10-14(11-16)17(12-15)9-8-13-6-4-3-5-7-13;/h3-7,12,14H,8-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ANIGHXJJPYBKSY-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|