C15H21Br2N — CID 16751987
2-(bromomethyl)-4,4-dimethyl-1-[(1R)-1-phenylethyl]-2,3-dihydropyrrol-1-ium bromide (PubChem CID 16751987) has the molecular formula C15H21Br2N and a molecular weight of 375.15 g/mol. Its IUPAC name is 2-(bromomethyl)-4,4-dimethyl-1-[(1R)-1-phenylethyl]-2,3-dihydropyrrol-1-ium bromide.
| Compound Name | 2-(bromomethyl)-4,4-dimethyl-1-[(1R)-1-phenylethyl]-2,3-dihydropyrrol-1-ium bromide |
|---|---|
| PubChem CID | 16751987 |
| Molecular Formula | C15H21Br2N |
| Molecular Weight | 375.15 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2-(bromomethyl)-4,4-dimethyl-1-[(1R)-1-phenylethyl]-2,3-dihydropyrrol-1-ium bromide |
| SMILES | C[C@H](c1ccccc1)[N+]1=CC(C)(C)CC1CBr.[Br-] |
| InChI | InChI=1S/C15H21BrN.BrH/c1-12(13-7-5-4-6-8-13)17-11-15(2,3)9-14(17)10-16;/h4-8,11-12,14H,9-10H2,1-3H3;1H/q+1;/p-1/t12-,14?;/m1./s1 |
| InChIKey | NAPLPRUMUYZOHL-UYUUDJTFSA-M |
| XLogP | 1.03 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.15 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|