About cumene;1-propan-2-ylbicyclo[1.1.0]butane
cumene;1-propan-2-ylbicyclo[1.1.0]butane (PubChem CID 176998151) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is cumene;1-propan-2-ylbicyclo[1.1.0]butane.
Molecular Properties
| Compound Name | cumene;1-propan-2-ylbicyclo[1.1.0]butane |
| PubChem CID | 176998151 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | cumene;1-propan-2-ylbicyclo[1.1.0]butane |
| SMILES | CC(C)C12CC1C2.CC(C)c1ccccc1 |
| InChI | InChI=1S/C9H12.C7H12/c1-8(2)9-6-4-3-5-7-9;1-5(2)7-3-6(7)4-7/h3-8H,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | WSDSJRSTYUKCPX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene;1-propan-2-ylbicyclo[1.1.0]butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;1-propan-2-ylbicyclo[1.1.0]butane?
The IUPAC name of cumene;1-propan-2-ylbicyclo[1.1.0]butane (CID 176998151) is cumene;1-propan-2-ylbicyclo[1.1.0]butane.
What is the SMILES notation for cumene;1-propan-2-ylbicyclo[1.1.0]butane?
The canonical SMILES for cumene;1-propan-2-ylbicyclo[1.1.0]butane is CC(C)C12CC1C2.CC(C)c1ccccc1.
What is the InChIKey of cumene;1-propan-2-ylbicyclo[1.1.0]butane?
The InChIKey is WSDSJRSTYUKCPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C7H12/c1-8(2)9-6-4-3-5-7-9;1-5(2)7-3-6(7)4-7/h3-8H,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of cumene;1-propan-2-ylbicyclo[1.1.0]butane?
cumene;1-propan-2-ylbicyclo[1.1.0]butane has a molecular weight of 216.37 g/mol, XLogP of 4.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;1-propan-2-ylbicyclo[1.1.0]butane is sourced from PubChem (CID 176998151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).