C13H18Br2P+ — CID 6332883
3,4-dibromo-1-methyl-1-(2-phenylethyl)phospholan-1-ium (PubChem CID 6332883) has the molecular formula C13H18Br2P+ and a molecular weight of 365.07 g/mol. Its IUPAC name is 3,4-dibromo-1-methyl-1-(2-phenylethyl)phospholan-1-ium.
| Compound Name | 3,4-dibromo-1-methyl-1-(2-phenylethyl)phospholan-1-ium |
|---|---|
| PubChem CID | 6332883 |
| Molecular Formula | C13H18Br2P+ |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 3,4-dibromo-1-methyl-1-(2-phenylethyl)phospholan-1-ium |
| SMILES | C[P+]1(CCc2ccccc2)CC(Br)C(Br)C1 |
| InChI | InChI=1S/C13H18Br2P/c1-16(9-12(14)13(15)10-16)8-7-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/q+1 |
| InChIKey | SULBQFMNGDLDNG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|