C12H14BrNS — CID 134098173
4-methyl-3-(2-phenylethyl)-1,3-thiazol-3-ium bromide (PubChem CID 134098173) has the molecular formula C12H14BrNS and a molecular weight of 284.22 g/mol. Its IUPAC name is 4-methyl-3-(2-phenylethyl)-1,3-thiazol-3-ium bromide.
| Compound Name | 4-methyl-3-(2-phenylethyl)-1,3-thiazol-3-ium bromide |
|---|---|
| PubChem CID | 134098173 |
| Molecular Formula | C12H14BrNS |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 4-methyl-3-(2-phenylethyl)-1,3-thiazol-3-ium bromide |
| SMILES | Cc1csc[n+]1CCc1ccccc1.[Br-] |
| InChI | InChI=1S/C12H14NS.BrH/c1-11-9-14-10-13(11)8-7-12-5-3-2-4-6-12;/h2-6,9-10H,7-8H2,1H3;1H/q+1;/p-1 |
| InChIKey | NYZLJQUGTQCCFK-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|