C12H14NS+ — CID 134098174
4-methyl-3-(2-phenylethyl)-1,3-thiazol-3-ium (PubChem CID 134098174) has the molecular formula C12H14NS+ and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-methyl-3-(2-phenylethyl)-1,3-thiazol-3-ium.
| Compound Name | 4-methyl-3-(2-phenylethyl)-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 134098174 |
| Molecular Formula | C12H14NS+ |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 4-methyl-3-(2-phenylethyl)-1,3-thiazol-3-ium |
| SMILES | Cc1csc[n+]1CCc1ccccc1 |
| InChI | InChI=1S/C12H14NS/c1-11-9-14-10-13(11)8-7-12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3/q+1 |
| InChIKey | MQVBRYJPJYVFNU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|