C13H18O — CID 10535692
[(1R,2R)-2-methyl-2-(2-phenylethyl)cyclopropyl]methanol (PubChem CID 10535692) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is [(1R,2R)-2-methyl-2-(2-phenylethyl)cyclopropyl]methanol.
| Compound Name | [(1R,2R)-2-methyl-2-(2-phenylethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 10535692 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | [(1R,2R)-2-methyl-2-(2-phenylethyl)cyclopropyl]methanol |
| SMILES | C[C@@]1(CCc2ccccc2)C[C@H]1CO |
| InChI | InChI=1S/C13H18O/c1-13(9-12(13)10-14)8-7-11-5-3-2-4-6-11/h2-6,12,14H,7-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | DZDIWKDXKXDZDF-QWHCGFSZSA-N |
| XLogP | 2.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |