C15H26O2Si2 — CID 175017688
[2,6,6-trimethyl-5-(2-phenylethyl)oxasilinan-2-yl]oxysilane (PubChem CID 175017688) has the molecular formula C15H26O2Si2 and a molecular weight of 294.54 g/mol. Its IUPAC name is [2,6,6-trimethyl-5-(2-phenylethyl)oxasilinan-2-yl]oxysilane.
| Compound Name | [2,6,6-trimethyl-5-(2-phenylethyl)oxasilinan-2-yl]oxysilane |
|---|---|
| PubChem CID | 175017688 |
| Molecular Formula | C15H26O2Si2 |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [2,6,6-trimethyl-5-(2-phenylethyl)oxasilinan-2-yl]oxysilane |
| SMILES | CC1(C)O[Si](C)(O[SiH3])CCC1CCc1ccccc1 |
| InChI | InChI=1S/C15H26O2Si2/c1-15(2)14(11-12-19(3,16-15)17-18)10-9-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3,18H3 |
| InChIKey | LIKHUCINUNHJJT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|