C27H43NO5 — CID 91145846
3,7,9-triethyl-6,7,9-trimethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 91145846) has the molecular formula C27H43NO5 and a molecular weight of 461.64 g/mol. Its IUPAC name is 3,7,9-triethyl-6,7,9-trimethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 3,7,9-triethyl-6,7,9-trimethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 91145846 |
| Molecular Formula | C27H43NO5 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | 3,7,9-triethyl-6,7,9-trimethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCC1COC2(CC(C)(CC)N(OCCc3ccc(OCC4CO4)cc3)C(C)(CC)C2C)O1 |
| InChI | InChI=1S/C27H43NO5/c1-7-22-18-31-27(33-22)19-25(5,8-2)28(26(6,9-3)20(27)4)32-15-14-21-10-12-23(13-11-21)29-16-24-17-30-24/h10-13,20,22,24H,7-9,14-19H2,1-6H3 |
| InChIKey | HPQPZBIJAJLKAK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|