C22H33NO5 — CID 90711548
7,7,9,9-tetramethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 90711548) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is 7,7,9,9-tetramethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 7,7,9,9-tetramethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 90711548 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 7,7,9,9-tetramethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CC1(C)CC2(CC(C)(C)N1OCCc1ccc(OCC3CO3)cc1)OCCO2 |
| InChI | InChI=1S/C22H33NO5/c1-20(2)15-22(26-11-12-27-22)16-21(3,4)23(20)28-10-9-17-5-7-18(8-6-17)24-13-19-14-25-19/h5-8,19H,9-16H2,1-4H3 |
| InChIKey | HCMVTRWLOUOKAI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|