C26H41NO5 — CID 91352147
3-butyl-7,7,9,9-tetramethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 91352147) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is 3-butyl-7,7,9,9-tetramethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 3-butyl-7,7,9,9-tetramethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 91352147 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | 3-butyl-7,7,9,9-tetramethyl-8-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCCCC1COC2(CC(C)(C)N(OCCc3ccc(OCC4CO4)cc3)C(C)(C)C2)O1 |
| InChI | InChI=1S/C26H41NO5/c1-6-7-8-22-17-30-26(32-22)18-24(2,3)27(25(4,5)19-26)31-14-13-20-9-11-21(12-10-20)28-15-23-16-29-23/h9-12,22-23H,6-8,13-19H2,1-5H3 |
| InChIKey | NHIGPWDCKHACCV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|