C30H45NO5 — CID 90842525
13,13-diethyl-11,11-dimethyl-12-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-8,15-dioxa-12-azadispiro[5.2.59.26]hexadec-3-ene (PubChem CID 90842525) has the molecular formula C30H45NO5 and a molecular weight of 499.69 g/mol. Its IUPAC name is 13,13-diethyl-11,11-dimethyl-12-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-8,15-dioxa-12-azadispiro[5.2.59.26]hexadec-3-ene.
| Compound Name | 13,13-diethyl-11,11-dimethyl-12-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-8,15-dioxa-12-azadispiro[5.2.59.26]hexadec-3-ene |
|---|---|
| PubChem CID | 90842525 |
| Molecular Formula | C30H45NO5 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | 13,13-diethyl-11,11-dimethyl-12-[2-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-8,15-dioxa-12-azadispiro[5.2.59.26]hexadec-3-ene |
| SMILES | CCC1(CC)CC2(CC(C)(C)N1OCCc1ccc(OCC3CO3)cc1)OCC1(CC=CCC1)CO2 |
| InChI | InChI=1S/C30H45NO5/c1-5-29(6-2)21-30(34-22-28(23-35-30)15-8-7-9-16-28)20-27(3,4)31(29)36-17-14-24-10-12-25(13-11-24)32-18-26-19-33-26/h7-8,10-13,26H,5-6,9,14-23H2,1-4H3 |
| InChIKey | XCOYFGUFCSPJPH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|