C32H53NO5 — CID 23615053
7,7-diethyl-9,9-dimethyl-3-octyl-8-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 23615053) has the molecular formula C32H53NO5 and a molecular weight of 531.78 g/mol. Its IUPAC name is 7,7-diethyl-9,9-dimethyl-3-octyl-8-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 7,7-diethyl-9,9-dimethyl-3-octyl-8-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 23615053 |
| Molecular Formula | C32H53NO5 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.39 |
| IUPAC Name | 7,7-diethyl-9,9-dimethyl-3-octyl-8-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCCCCCCCC1COC2(CC(C)(C)N(OC(C)c3ccc(OCC4CO4)cc3)C(CC)(CC)C2)O1 |
| InChI | InChI=1S/C32H53NO5/c1-7-10-11-12-13-14-15-28-22-36-32(37-28)23-30(5,6)33(31(8-2,9-3)24-32)38-25(4)26-16-18-27(19-17-26)34-20-29-21-35-29/h16-19,25,28-29H,7-15,20-24H2,1-6H3 |
| InChIKey | NALOXNJJUVDPDQ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|