C27H41NO7 — CID 58759293
[3,8,8,10,10-pentamethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl acetate (PubChem CID 58759293) has the molecular formula C27H41NO7 and a molecular weight of 491.63 g/mol. Its IUPAC name is [3,8,8,10,10-pentamethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl acetate.
| Compound Name | [3,8,8,10,10-pentamethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 58759293 |
| Molecular Formula | C27H41NO7 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | [3,8,8,10,10-pentamethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1(C)COC2(CC(C)(C)N(OC(C)c3ccc(OCC4CO4)cc3)C(C)(C)C2)OC1 |
| InChI | InChI=1S/C27H41NO7/c1-19(21-8-10-22(11-9-21)30-12-23-13-31-23)35-28-24(3,4)14-27(15-25(28,5)6)33-17-26(7,18-34-27)16-32-20(2)29/h8-11,19,23H,12-18H2,1-7H3 |
| InChIKey | KRSTYCWBQPQYGT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|