C64H100N2O14 — CID 58891829
bis[[8,10-diethyl-3,8,10,11-tetramethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl] octanedioate (PubChem CID 58891829) has the molecular formula C64H100N2O14 and a molecular weight of 1121.50 g/mol. Its IUPAC name is bis[[8,10-diethyl-3,8,10,11-tetramethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl] octanedioate.
| Compound Name | bis[[8,10-diethyl-3,8,10,11-tetramethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl] octanedioate |
|---|---|
| PubChem CID | 58891829 |
| Molecular Formula | C64H100N2O14 |
| Molecular Weight | 1121.50 g/mol |
| Exact Mass | 1120.72 |
| IUPAC Name | bis[[8,10-diethyl-3,8,10,11-tetramethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl] octanedioate |
| SMILES | CCC1(C)CC2(OCC(C)(COC(=O)CCCCCCC(=O)OCC3(C)COC4(CC(C)(CC)N(OC(C)c5ccc(OCC6CO6)cc5)C(C)(CC)C4C)OC3)CO2)C(C)C(C)(CC)N1OC(C)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C64H100N2O14/c1-15-59(11)37-63(47(7)61(13,17-3)65(59)79-45(5)49-25-29-51(30-26-49)69-33-53-35-71-53)75-41-57(9,42-76-63)39-73-55(67)23-21-19-20-22-24-56(68)74-40-58(10)43-77-64(78-44-58)38-60(12,16-2)66(62(14,18-4)48(64)8)80-46(6)50-27-31-52(32-28-50)70-34-54-36-72-54/h25-32,45-48,53-54H,15-24,33-44H2,1-14H3 |
| InChIKey | IMMHJHLXSXFULI-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 157.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.50 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|