C58H88N2O14 — CID 58759297
bis[[3,8,8,10,10-pentamethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl] octanedioate (PubChem CID 58759297) has the molecular formula C58H88N2O14 and a molecular weight of 1037.34 g/mol. Its IUPAC name is bis[[3,8,8,10,10-pentamethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl] octanedioate.
| Compound Name | bis[[3,8,8,10,10-pentamethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl] octanedioate |
|---|---|
| PubChem CID | 58759297 |
| Molecular Formula | C58H88N2O14 |
| Molecular Weight | 1037.34 g/mol |
| Exact Mass | 1036.62 |
| IUPAC Name | bis[[3,8,8,10,10-pentamethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methyl] octanedioate |
| SMILES | CC(ON1C(C)(C)CC2(CC1(C)C)OCC(C)(COC(=O)CCCCCCC(=O)OCC1(C)COC3(CC(C)(C)N(OC(C)c4ccc(OCC5CO5)cc4)C(C)(C)C3)OC1)CO2)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C58H88N2O14/c1-41(43-19-23-45(24-20-43)63-27-47-29-65-47)73-59-51(3,4)31-57(32-52(59,5)6)69-37-55(11,38-70-57)35-67-49(61)17-15-13-14-16-18-50(62)68-36-56(12)39-71-58(72-40-56)33-53(7,8)60(54(9,10)34-58)74-42(2)44-21-25-46(26-22-44)64-28-48-30-66-48/h19-26,41-42,47-48H,13-18,27-40H2,1-12H3 |
| InChIKey | GFZUCLSKYUDKKY-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 157.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.34 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|