C25H39NO5 — CID 58891862
3,3,8,8,10,10-hexamethyl-9-[1-[3-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 58891862) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is 3,3,8,8,10,10-hexamethyl-9-[1-[3-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 3,3,8,8,10,10-hexamethyl-9-[1-[3-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 58891862 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 3,3,8,8,10,10-hexamethyl-9-[1-[3-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CC(ON1C(C)(C)CC2(CC1(C)C)OCC(C)(C)CO2)c1cccc(OCC2CO2)c1 |
| InChI | InChI=1S/C25H39NO5/c1-18(19-9-8-10-20(11-19)27-12-21-13-28-21)31-26-23(4,5)14-25(15-24(26,6)7)29-16-22(2,3)17-30-25/h8-11,18,21H,12-17H2,1-7H3 |
| InChIKey | XJZMYLBWYVXZKS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|