C32H51NO7 — CID 139991340
4,4-bis(cyclohexylperoxy)-2,2,6,6-tetramethyl-1-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]piperidine (PubChem CID 139991340) has the molecular formula C32H51NO7 and a molecular weight of 561.76 g/mol. Its IUPAC name is 4,4-bis(cyclohexylperoxy)-2,2,6,6-tetramethyl-1-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]piperidine.
| Compound Name | 4,4-bis(cyclohexylperoxy)-2,2,6,6-tetramethyl-1-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]piperidine |
|---|---|
| PubChem CID | 139991340 |
| Molecular Formula | C32H51NO7 |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.37 |
| IUPAC Name | 4,4-bis(cyclohexylperoxy)-2,2,6,6-tetramethyl-1-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]piperidine |
| SMILES | CC(ON1C(C)(C)CC(OOC2CCCCC2)(OOC2CCCCC2)CC1(C)C)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C32H51NO7/c1-24(25-16-18-26(19-17-25)34-20-29-21-35-29)36-33-30(2,3)22-32(23-31(33,4)5,39-37-27-12-8-6-9-13-27)40-38-28-14-10-7-11-15-28/h16-19,24,27-29H,6-15,20-23H2,1-5H3 |
| InChIKey | AQGSZZJZSOQKTR-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|