C48H72N2O10 — CID 58982360
bis[[7,7,9,9-tetramethyl-8-(1-phenylethoxy)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] octanedioate (PubChem CID 58982360) has the molecular formula C48H72N2O10 and a molecular weight of 837.11 g/mol. Its IUPAC name is bis[[7,7,9,9-tetramethyl-8-(1-phenylethoxy)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] octanedioate.
| Compound Name | bis[[7,7,9,9-tetramethyl-8-(1-phenylethoxy)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] octanedioate |
|---|---|
| PubChem CID | 58982360 |
| Molecular Formula | C48H72N2O10 |
| Molecular Weight | 837.11 g/mol |
| Exact Mass | 836.52 |
| IUPAC Name | bis[[7,7,9,9-tetramethyl-8-(1-phenylethoxy)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] octanedioate |
| SMILES | CC(ON1C(C)(C)CC2(CC1(C)C)OCC(COC(=O)CCCCCCC(=O)OCC1COC3(CC(C)(C)N(OC(C)c4ccccc4)C(C)(C)C3)O1)O2)c1ccccc1 |
| InChI | InChI=1S/C48H72N2O10/c1-35(37-21-15-13-16-22-37)59-49-43(3,4)31-47(32-44(49,5)6)55-29-39(57-47)27-53-41(51)25-19-11-12-20-26-42(52)54-28-40-30-56-48(58-40)33-45(7,8)50(46(9,10)34-48)60-36(2)38-23-17-14-18-24-38/h13-18,21-24,35-36,39-40H,11-12,19-20,25-34H2,1-10H3 |
| InChIKey | CXYYPSUWYUXNPR-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.11 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|