C62H84N2O10 — CID 20771162
bis[1-[4-[1-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl]phenyl]ethyl] decanedioate (PubChem CID 20771162) has the molecular formula C62H84N2O10 and a molecular weight of 1017.36 g/mol. Its IUPAC name is bis[1-[4-[1-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl]phenyl]ethyl] decanedioate.
| Compound Name | bis[1-[4-[1-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl]phenyl]ethyl] decanedioate |
|---|---|
| PubChem CID | 20771162 |
| Molecular Formula | C62H84N2O10 |
| Molecular Weight | 1017.36 g/mol |
| Exact Mass | 1016.61 |
| IUPAC Name | bis[1-[4-[1-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl]phenyl]ethyl] decanedioate |
| SMILES | CC(OC(=O)CCCCCCCCC(=O)OC(C)c1ccc(C(C)ON2C(C)(C)CC(OC(=O)c3ccccc3)CC2(C)C)cc1)c1ccc(C(C)ON2C(C)(C)CC(OC(=O)c3ccccc3)CC2(C)C)cc1 |
| InChI | InChI=1S/C62H84N2O10/c1-43(47-31-35-49(36-32-47)45(3)73-63-59(5,6)39-53(40-60(63,7)8)71-57(67)51-25-19-17-20-26-51)69-55(65)29-23-15-13-14-16-24-30-56(66)70-44(2)48-33-37-50(38-34-48)46(4)74-64-61(9,10)41-54(42-62(64,11)12)72-58(68)52-27-21-18-22-28-52/h17-22,25-28,31-38,43-46,53-54H,13-16,23-24,29-30,39-42H2,1-12H3 |
| InChIKey | VJWWVAWRRUGRDD-UHFFFAOYSA-N |
| XLogP | 14.46 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.36 |
| LogP ≤ 5 | 14.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|