C51H78N3O6P — CID 54125950
tris[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] phosphite (PubChem CID 54125950) has the molecular formula C51H78N3O6P and a molecular weight of 860.17 g/mol. Its IUPAC name is tris[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] phosphite.
| Compound Name | tris[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] phosphite |
|---|---|
| PubChem CID | 54125950 |
| Molecular Formula | C51H78N3O6P |
| Molecular Weight | 860.17 g/mol |
| Exact Mass | 859.56 |
| IUPAC Name | tris[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl] phosphite |
| SMILES | CC(ON1C(C)(C)CC(OP(OC2CC(C)(C)N(OC(C)c3ccccc3)C(C)(C)C2)OC2CC(C)(C)N(OC(C)c3ccccc3)C(C)(C)C2)CC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C51H78N3O6P/c1-37(40-25-19-16-20-26-40)55-52-46(4,5)31-43(32-47(52,6)7)58-61(59-44-33-48(8,9)53(49(10,11)34-44)56-38(2)41-27-21-17-22-28-41)60-45-35-50(12,13)54(51(14,15)36-45)57-39(3)42-29-23-18-24-30-42/h16-30,37-39,43-45H,31-36H2,1-15H3 |
| InChIKey | NQYXQRDGKSERTL-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.17 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|