C33H44N2O7 — CID 67852784
[1-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycarbonyloxy-2,2,6,6-tetramethylpiperidin-4-yl] benzoate (PubChem CID 67852784) has the molecular formula C33H44N2O7 and a molecular weight of 580.72 g/mol. Its IUPAC name is [1-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycarbonyloxy-2,2,6,6-tetramethylpiperidin-4-yl] benzoate.
| Compound Name | [1-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycarbonyloxy-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 67852784 |
| Molecular Formula | C33H44N2O7 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | [1-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)oxycarbonyloxy-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1OC(=O)ON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C33H44N2O7/c1-30(2)19-25(39-27(36)23-15-11-9-12-16-23)20-31(3,4)34(30)41-29(38)42-35-32(5,6)21-26(22-33(35,7)8)40-28(37)24-17-13-10-14-18-24/h9-18,25-26H,19-22H2,1-8H3 |
| InChIKey | PXGBVJQYSJCSMP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |