C60H89N3O12 — CID 20510591
[1-[3-[2,3-bis[3-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)-2-hydroxypropoxy]propoxy]-2-hydroxypropyl]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate (PubChem CID 20510591) has the molecular formula C60H89N3O12 and a molecular weight of 1044.38 g/mol. Its IUPAC name is [1-[3-[2,3-bis[3-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)-2-hydroxypropoxy]propoxy]-2-hydroxypropyl]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate.
| Compound Name | [1-[3-[2,3-bis[3-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)-2-hydroxypropoxy]propoxy]-2-hydroxypropyl]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 20510591 |
| Molecular Formula | C60H89N3O12 |
| Molecular Weight | 1044.38 g/mol |
| Exact Mass | 1043.64 |
| IUPAC Name | [1-[3-[2,3-bis[3-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)-2-hydroxypropoxy]propoxy]-2-hydroxypropyl]-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1CC(O)COCC(COCC(O)CN1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C)OCC(O)CN1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C60H89N3O12/c1-55(2)28-48(73-52(67)42-22-16-13-17-23-42)29-56(3,4)61(55)34-45(64)37-70-40-51(72-39-47(66)36-63-59(9,10)32-50(33-60(63,11)12)75-54(69)44-26-20-15-21-27-44)41-71-38-46(65)35-62-57(5,6)30-49(31-58(62,7)8)74-53(68)43-24-18-14-19-25-43/h13-27,45-51,64-66H,28-41H2,1-12H3 |
| InChIKey | JBRLXRWYJQLJGD-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.38 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|