C19H27NO3 — CID 139992173
(1-benzoyl-2,2,6,6-tetramethylpiperidin-4-yl) propanoate (PubChem CID 139992173) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (1-benzoyl-2,2,6,6-tetramethylpiperidin-4-yl) propanoate.
| Compound Name | (1-benzoyl-2,2,6,6-tetramethylpiperidin-4-yl) propanoate |
|---|---|
| PubChem CID | 139992173 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (1-benzoyl-2,2,6,6-tetramethylpiperidin-4-yl) propanoate |
| SMILES | CCC(=O)OC1CC(C)(C)N(C(=O)c2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C19H27NO3/c1-6-16(21)23-15-12-18(2,3)20(19(4,5)13-15)17(22)14-10-8-7-9-11-14/h7-11,15H,6,12-13H2,1-5H3 |
| InChIKey | WPQIHQQMIYILCT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |