C34H54N2O4 — CID 59107242
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-benzylideneheptanedioate (PubChem CID 59107242) has the molecular formula C34H54N2O4 and a molecular weight of 554.82 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-benzylideneheptanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-benzylideneheptanedioate |
|---|---|
| PubChem CID | 59107242 |
| Molecular Formula | C34H54N2O4 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.41 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-benzylideneheptanedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)CCC(=Cc2ccccc2)CCC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C34H54N2O4/c1-31(2)21-27(22-32(3,4)35(31)9)39-29(37)18-16-26(20-25-14-12-11-13-15-25)17-19-30(38)40-28-23-33(5,6)36(10)34(7,8)24-28/h11-15,20,27-28H,16-19,21-24H2,1-10H3 |
| InChIKey | ZMSVKQIDXGGWNH-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |