C23H35NO4 — CID 57064867
[2-hydroxy-3-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)propyl] but-2-enoate (PubChem CID 57064867) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is [2-hydroxy-3-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)propyl] but-2-enoate.
| Compound Name | [2-hydroxy-3-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)propyl] but-2-enoate |
|---|---|
| PubChem CID | 57064867 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | [2-hydroxy-3-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)propyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)CN1C(C)(C)CC(OCc2ccccc2)CC1(C)C |
| InChI | InChI=1S/C23H35NO4/c1-6-10-21(26)28-17-19(25)15-24-22(2,3)13-20(14-23(24,4)5)27-16-18-11-8-7-9-12-18/h6-12,19-20,25H,13-17H2,1-5H3 |
| InChIKey | RVGXMJTUWNHXAU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|