C13H18BNO4 — CID 58601841
1-[[hydroxy(methyl)boranyl]amino]-3-phenylmethoxycyclobutane-1-carboxylic acid (PubChem CID 58601841) has the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. Its IUPAC name is 1-[[hydroxy(methyl)boranyl]amino]-3-phenylmethoxycyclobutane-1-carboxylic acid.
| Compound Name | 1-[[hydroxy(methyl)boranyl]amino]-3-phenylmethoxycyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 58601841 |
| Molecular Formula | C13H18BNO4 |
| Molecular Weight | 263.10 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-[[hydroxy(methyl)boranyl]amino]-3-phenylmethoxycyclobutane-1-carboxylic acid |
| SMILES | CB(O)NC1(C(=O)O)CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C13H18BNO4/c1-14(18)15-13(12(16)17)7-11(8-13)19-9-10-5-3-2-4-6-10/h2-6,11,15,18H,7-9H2,1H3,(H,16,17) |
| InChIKey | VTRPLYZHQVDDEW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.10 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|