C12H24NO- — CID 22182255
2,6-diethyl-2,3,6-trimethyl-1-oxidopiperidine (PubChem CID 22182255) has the molecular formula C12H24NO- and a molecular weight of 198.33 g/mol. Its IUPAC name is 2,6-diethyl-2,3,6-trimethyl-1-oxidopiperidine.
| Compound Name | 2,6-diethyl-2,3,6-trimethyl-1-oxidopiperidine |
|---|---|
| PubChem CID | 22182255 |
| Molecular Formula | C12H24NO- |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.19 |
| IUPAC Name | 2,6-diethyl-2,3,6-trimethyl-1-oxidopiperidine |
| SMILES | CCC1(C)CCC(C)C(C)(CC)N1[O-] |
| InChI | InChI=1S/C12H24NO/c1-6-11(4)9-8-10(3)12(5,7-2)13(11)14/h10H,6-9H2,1-5H3/q-1 |
| InChIKey | WBRPBTPGUXPAJV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |