C13H26N2O — CID 57208979
2,6-diethyl-2,3,6-trimethylpiperidine-1-carboxamide (PubChem CID 57208979) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,6-diethyl-2,3,6-trimethylpiperidine-1-carboxamide.
| Compound Name | 2,6-diethyl-2,3,6-trimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 57208979 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 2,6-diethyl-2,3,6-trimethylpiperidine-1-carboxamide |
| SMILES | CCC1(C)CCC(C)C(C)(CC)N1C(N)=O |
| InChI | InChI=1S/C13H26N2O/c1-6-12(4)9-8-10(3)13(5,7-2)15(12)11(14)16/h10H,6-9H2,1-5H3,(H2,14,16) |
| InChIKey | FFNRWIPBARZHIZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |