C14H29NO2Y — CID 58891864
2,6-diethyl-4-methoxy-1,2,3,6-tetramethylpiperidin-4-ol;yttrium (PubChem CID 58891864) has the molecular formula C14H29NO2Y and a molecular weight of 332.30 g/mol. Its IUPAC name is 2,6-diethyl-4-methoxy-1,2,3,6-tetramethylpiperidin-4-ol;yttrium.
| Compound Name | 2,6-diethyl-4-methoxy-1,2,3,6-tetramethylpiperidin-4-ol;yttrium |
|---|---|
| PubChem CID | 58891864 |
| Molecular Formula | C14H29NO2Y |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,6-diethyl-4-methoxy-1,2,3,6-tetramethylpiperidin-4-ol;yttrium |
| SMILES | CCC1(C)CC(O)(OC)C(C)C(C)(CC)N1C.[Y] |
| InChI | InChI=1S/C14H29NO2.Y/c1-8-12(4)10-14(16,17-7)11(3)13(5,9-2)15(12)6;/h11,16H,8-10H2,1-7H3; |
| InChIKey | DLKCBOKDDJUTGI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|