C28H52N2O6 — CID 175491558
bis(1,2,2,3-tetramethyl-1-oxidopiperidin-1-ium-4-yl) decanedioate (PubChem CID 175491558) has the molecular formula C28H52N2O6 and a molecular weight of 512.73 g/mol. Its IUPAC name is bis(1,2,2,3-tetramethyl-1-oxidopiperidin-1-ium-4-yl) decanedioate.
| Compound Name | bis(1,2,2,3-tetramethyl-1-oxidopiperidin-1-ium-4-yl) decanedioate |
|---|---|
| PubChem CID | 175491558 |
| Molecular Formula | C28H52N2O6 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.38 |
| IUPAC Name | bis(1,2,2,3-tetramethyl-1-oxidopiperidin-1-ium-4-yl) decanedioate |
| SMILES | CC1C(OC(=O)CCCCCCCCC(=O)OC2CC[N+](C)([O-])C(C)(C)C2C)CC[N+](C)([O-])C1(C)C |
| InChI | InChI=1S/C28H52N2O6/c1-21-23(17-19-29(7,33)27(21,3)4)35-25(31)15-13-11-9-10-12-14-16-26(32)36-24-18-20-30(8,34)28(5,6)22(24)2/h21-24H,9-20H2,1-8H3 |
| InChIKey | SSGCJTMVQMIXCA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|