C24H31NO3 — CID 67876077
(1,2,2,6,6-pentamethyl-3-phenylmethoxypiperidin-4-yl) benzoate (PubChem CID 67876077) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethyl-3-phenylmethoxypiperidin-4-yl) benzoate.
| Compound Name | (1,2,2,6,6-pentamethyl-3-phenylmethoxypiperidin-4-yl) benzoate |
|---|---|
| PubChem CID | 67876077 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (1,2,2,6,6-pentamethyl-3-phenylmethoxypiperidin-4-yl) benzoate |
| SMILES | CN1C(C)(C)CC(OC(=O)c2ccccc2)C(OCc2ccccc2)C1(C)C |
| InChI | InChI=1S/C24H31NO3/c1-23(2)16-20(28-22(26)19-14-10-7-11-15-19)21(24(3,4)25(23)5)27-17-18-12-8-6-9-13-18/h6-15,20-21H,16-17H2,1-5H3 |
| InChIKey | WWPKCOPDHVDELP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |