C22H24O3 — CID 10854364
[(1S,2S,5R,6R)-2,6-dimethyl-5-phenylmethoxycyclohex-3-en-1-yl] benzoate (PubChem CID 10854364) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is [(1S,2S,5R,6R)-2,6-dimethyl-5-phenylmethoxycyclohex-3-en-1-yl] benzoate.
| Compound Name | [(1S,2S,5R,6R)-2,6-dimethyl-5-phenylmethoxycyclohex-3-en-1-yl] benzoate |
|---|---|
| PubChem CID | 10854364 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [(1S,2S,5R,6R)-2,6-dimethyl-5-phenylmethoxycyclohex-3-en-1-yl] benzoate |
| SMILES | C[C@H]1[C@@H](OC(=O)c2ccccc2)[C@@H](C)C=C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H24O3/c1-16-13-14-20(24-15-18-9-5-3-6-10-18)17(2)21(16)25-22(23)19-11-7-4-8-12-19/h3-14,16-17,20-21H,15H2,1-2H3/t16-,17+,20+,21-/m0/s1 |
| InChIKey | JRCGZQNKMSAZTJ-NLEAXPPASA-N |
| XLogP | 4.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|