C15H22O5 — CID 162861618
(1S,6S,7S,8R,10S,11R,13S)-8,11-dihydroxy-6,7,13-trimethyl-4,9-dioxatetracyclo[6.5.1.01,10.06,10]tetradecan-3-one (PubChem CID 162861618) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1S,6S,7S,8R,10S,11R,13S)-8,11-dihydroxy-6,7,13-trimethyl-4,9-dioxatetracyclo[6.5.1.01,10.06,10]tetradecan-3-one.
| Compound Name | (1S,6S,7S,8R,10S,11R,13S)-8,11-dihydroxy-6,7,13-trimethyl-4,9-dioxatetracyclo[6.5.1.01,10.06,10]tetradecan-3-one |
|---|---|
| PubChem CID | 162861618 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1S,6S,7S,8R,10S,11R,13S)-8,11-dihydroxy-6,7,13-trimethyl-4,9-dioxatetracyclo[6.5.1.01,10.06,10]tetradecan-3-one |
| SMILES | C[C@@H]1[C@@]2(O)C[C@@]34CC(=O)OC[C@@]1(C)[C@]3(O2)[C@H](O)C[C@@H]4C |
| InChI | InChI=1S/C15H22O5/c1-8-4-10(16)15-12(3)7-19-11(17)5-13(8,15)6-14(18,20-15)9(12)2/h8-10,16,18H,4-7H2,1-3H3/t8-,9-,10+,12+,13+,14+,15+/m0/s1 |
| InChIKey | RTLVPDMQZGDKSX-QGVGAQFYSA-N |
| XLogP | 0.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |